![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/fancy-index/icons/back.svg){kind=icon}
![[DIR]](/fancy-index/icons/file-directory.svg){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1_Regulatory Topics and Guidelines/ | 2014-04-30 16:36 | - | |
| 2_Subgroup Analysis/ | 2014-04-30 16:36 | - | |
| 3_Multiple Comparison/ | 2014-04-30 16:36 | - | |
| 4_Recent Advances in Time-to-Event Models/ | 2014-04-30 16:36 | - | |
| 5_HTA/ | 2014-04-30 16:36 | - | |
| 6_Multiregional Trials/ | 2014-04-30 16:36 | - | |
| 7_Multistate Models - Cure Models/ | 2014-04-30 16:36 | - | |
| 8_Flexible and Adaptive Designs/ | 2014-04-30 16:36 | - | |
| 9_Analysis of Registries/ | 2014-04-30 16:36 | - | |
| 10_Growth Curves/ | 2014-04-30 16:36 | - | |
| 11_Statistics in Drug Development/ | 2014-04-30 16:36 | - | |
| 12_Risk Prediction/ | 2014-04-30 16:36 | - | |
| 13_Mixed Data Analysis/ | 2014-04-30 16:36 | - | |
| 14_Young Statisticians/ | 2014-04-30 16:36 | - | |
| 15_Statistical Methods in Genetic Epidemiology/ | 2014-04-30 16:36 | - | |
| 16_Statistical Methods in Infectious Disease Epidemiology/ | 2014-04-30 16:36 | - | |
| 17_Statistical Evaluation of Biomarkers and Clinical Tools/ | 2014-04-30 16:36 | - | |
| 18_Biometrics/ | 2014-04-30 16:36 | - | |
| 19_EAST/ | 2014-04-30 16:36 | - | |